C26H39IN6O6 — CID 167299883
[4-[[(E,2S)-6-(carbamoylamino)-2-[[(2S)-3-methyl-2-(4-methylpentanoylamino)butanoyl]amino]hex-3-enoyl]amino]phenyl]methyl N-iodocarbamate (PubChem CID 167299883) has the molecular formula C26H39IN6O6 and a molecular weight of 658.54 g/mol. Its IUPAC name is [4-[[(E,2S)-6-(carbamoylamino)-2-[[(2S)-3-methyl-2-(4-methylpentanoylamino)butanoyl]amino]hex-3-enoyl]amino]phenyl]methyl N-iodocarbamate.
| Compound Name | [4-[[(E,2S)-6-(carbamoylamino)-2-[[(2S)-3-methyl-2-(4-methylpentanoylamino)butanoyl]amino]hex-3-enoyl]amino]phenyl]methyl N-iodocarbamate |
|---|---|
| PubChem CID | 167299883 |
| Molecular Formula | C26H39IN6O6 |
| Molecular Weight | 658.54 g/mol |
| Exact Mass | 658.20 |
| IUPAC Name | [4-[[(E,2S)-6-(carbamoylamino)-2-[[(2S)-3-methyl-2-(4-methylpentanoylamino)butanoyl]amino]hex-3-enoyl]amino]phenyl]methyl N-iodocarbamate |
| SMILES | CC(C)CCC(=O)N[C@H](C(=O)N[C@@H](/C=C/CCNC(N)=O)C(=O)Nc1ccc(COC(=O)NI)cc1)C(C)C |
| InChI | InChI=1S/C26H39IN6O6/c1-16(2)8-13-21(34)32-22(17(3)4)24(36)31-20(7-5-6-14-29-25(28)37)23(35)30-19-11-9-18(10-12-19)15-39-26(38)33-27/h5,7,9-12,16-17,20,22H,6,8,13-15H2,1-4H3,(H,30,35)(H,31,36)(H,32,34)(H,33,38)(H3,28,29,37)/b7-5+/t20-,22-/m0/s1 |
| InChIKey | BQYOGCZCJUURQL-HKRUVYOCSA-N |
| XLogP | 2.88 |
| TPSA | 180.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|