C12H19N3S — CID 139572228
(4Z)-3-imino-2-N-methyl-7-prop-1-en-2-ylsulfanylocta-1,4,7-triene-2,5-diamine (PubChem CID 139572228) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is (4Z)-3-imino-2-N-methyl-7-prop-1-en-2-ylsulfanylocta-1,4,7-triene-2,5-diamine.
| Compound Name | (4Z)-3-imino-2-N-methyl-7-prop-1-en-2-ylsulfanylocta-1,4,7-triene-2,5-diamine |
|---|---|
| PubChem CID | 139572228 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | (4Z)-3-imino-2-N-methyl-7-prop-1-en-2-ylsulfanylocta-1,4,7-triene-2,5-diamine |
| SMILES | [H]/N=C(\C=C(/N)CC(=C)SC(=C)C)C(=C)NC |
| InChI | InChI=1S/C12H19N3S/c1-8(2)16-9(3)6-11(13)7-12(14)10(4)15-5/h7,14-15H,1,3-4,6,13H2,2,5H3/b11-7-,14-12+ |
| InChIKey | CEGHHYSKUQWALE-WJDJXFINSA-N |
| XLogP | 2.75 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|