C38H43Cl2N7O5 — CID 139617820
1-[1-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]propyl]-2-propyl-1,2,4-triazolidine-3,5-dione (PubChem CID 139617820) has the molecular formula C38H43Cl2N7O5 and a molecular weight of 748.71 g/mol. Its IUPAC name is 1-[1-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]propyl]-2-propyl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 1-[1-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]propyl]-2-propyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 139617820 |
| Molecular Formula | C38H43Cl2N7O5 |
| Molecular Weight | 748.71 g/mol |
| Exact Mass | 747.27 |
| IUPAC Name | 1-[1-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]propyl]-2-propyl-1,2,4-triazolidine-3,5-dione |
| SMILES | CCCn1c(=O)[nH]c(=O)n1C(CC)c1ccc(N2CCN(c3ccc(OCC4COC(Cn5ccnc5)(c5ccc(Cl)cc5Cl)O4)cc3)CC2)cc1 |
| InChI | InChI=1S/C38H43Cl2N7O5/c1-3-16-46-36(48)42-37(49)47(46)35(4-2)27-5-8-29(9-6-27)44-18-20-45(21-19-44)30-10-12-31(13-11-30)50-23-32-24-51-38(52-32,25-43-17-15-41-26-43)33-14-7-28(39)22-34(33)40/h5-15,17,22,26,32,35H,3-4,16,18-21,23-25H2,1-2H3,(H,42,48,49) |
| InChIKey | IQKQVSLQEMAMJE-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 111.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.71 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|