C18H14Br2N2O2 — CID 139631899
4-[3,6-bis(bromomethyl)-5-(4-hydroxyphenyl)pyrazin-2-yl]phenol (PubChem CID 139631899) has the molecular formula C18H14Br2N2O2 and a molecular weight of 450.13 g/mol. Its IUPAC name is 4-[3,6-bis(bromomethyl)-5-(4-hydroxyphenyl)pyrazin-2-yl]phenol.
| Compound Name | 4-[3,6-bis(bromomethyl)-5-(4-hydroxyphenyl)pyrazin-2-yl]phenol |
|---|---|
| PubChem CID | 139631899 |
| Molecular Formula | C18H14Br2N2O2 |
| Molecular Weight | 450.13 g/mol |
| Exact Mass | 447.94 |
| IUPAC Name | 4-[3,6-bis(bromomethyl)-5-(4-hydroxyphenyl)pyrazin-2-yl]phenol |
| SMILES | Oc1ccc(-c2nc(CBr)c(-c3ccc(O)cc3)nc2CBr)cc1 |
| InChI | InChI=1S/C18H14Br2N2O2/c19-9-15-17(11-1-5-13(23)6-2-11)21-16(10-20)18(22-15)12-3-7-14(24)8-4-12/h1-8,23-24H,9-10H2 |
| InChIKey | JWIRABREYRRQPZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.13 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|