C7H17NO8S — CID 139644299
[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methanesulfonic acid (PubChem CID 139644299) has the molecular formula C7H17NO8S and a molecular weight of 275.28 g/mol. Its IUPAC name is [[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methanesulfonic acid.
| Compound Name | [[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methanesulfonic acid |
|---|---|
| PubChem CID | 139644299 |
| Molecular Formula | C7H17NO8S |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | [[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methanesulfonic acid |
| SMILES | O=S(=O)(O)CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H17NO8S/c9-2-5(11)7(13)6(12)4(10)1-8-3-17(14,15)16/h4-13H,1-3H2,(H,14,15,16)/t4-,5+,6+,7+/m0/s1 |
| InChIKey | OYRGISNWOSMPTL-BDVNFPICSA-N |
| XLogP | -4.14 |
| TPSA | 167.55 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | -4.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|