C37H50N2 — CID 139644641
5-phenyl-2,3-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]-1,3-dihydropyrazole (PubChem CID 139644641) has the molecular formula C37H50N2 and a molecular weight of 522.82 g/mol. Its IUPAC name is 5-phenyl-2,3-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]-1,3-dihydropyrazole.
| Compound Name | 5-phenyl-2,3-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]-1,3-dihydropyrazole |
|---|---|
| PubChem CID | 139644641 |
| Molecular Formula | C37H50N2 |
| Molecular Weight | 522.82 g/mol |
| Exact Mass | 522.40 |
| IUPAC Name | 5-phenyl-2,3-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]-1,3-dihydropyrazole |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(C2C=C(c3ccccc3)NN2c2ccc(C(C)(C)CC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C37H50N2/c1-34(2,3)25-36(7,8)29-18-16-28(17-19-29)33-24-32(27-14-12-11-13-15-27)38-39(33)31-22-20-30(21-23-31)37(9,10)26-35(4,5)6/h11-24,33,38H,25-26H2,1-10H3 |
| InChIKey | KKBBMJZWHFNMTO-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.82 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |