C32H33O7PS — CID 139649733
dimethyl 2-[butyl(triphenyl)-λ5-phosphanyl]oxysulfonylbenzene-1,4-dicarboxylate (PubChem CID 139649733) has the molecular formula C32H33O7PS and a molecular weight of 592.65 g/mol. Its IUPAC name is dimethyl 2-[butyl(triphenyl)-λ5-phosphanyl]oxysulfonylbenzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[butyl(triphenyl)-λ5-phosphanyl]oxysulfonylbenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 139649733 |
| Molecular Formula | C32H33O7PS |
| Molecular Weight | 592.65 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | dimethyl 2-[butyl(triphenyl)-λ5-phosphanyl]oxysulfonylbenzene-1,4-dicarboxylate |
| SMILES | CCCCP(OS(=O)(=O)c1cc(C(=O)OC)ccc1C(=O)OC)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H33O7PS/c1-4-5-23-40(26-15-9-6-10-16-26,27-17-11-7-12-18-27,28-19-13-8-14-20-28)39-41(35,36)30-24-25(31(33)37-2)21-22-29(30)32(34)38-3/h6-22,24H,4-5,23H2,1-3H3 |
| InChIKey | HZWICDWNVVIAON-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.65 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|