C8H11F9O3Si — CID 139652864
ethyl-tris(2,2,2-trifluoroethoxy)silane (PubChem CID 139652864) has the molecular formula C8H11F9O3Si and a molecular weight of 354.24 g/mol. Its IUPAC name is ethyl-tris(2,2,2-trifluoroethoxy)silane.
| Compound Name | ethyl-tris(2,2,2-trifluoroethoxy)silane |
|---|---|
| PubChem CID | 139652864 |
| Molecular Formula | C8H11F9O3Si |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | ethyl-tris(2,2,2-trifluoroethoxy)silane |
| SMILES | CC[Si](OCC(F)(F)F)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C8H11F9O3Si/c1-2-21(18-3-6(9,10)11,19-4-7(12,13)14)20-5-8(15,16)17/h2-5H2,1H3 |
| InChIKey | PSLSGJVBYDKIME-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|