C27H44O7 — CID 139655837
triethyl 1-(3,7,11-trimethyldodeca-2,6,10-trienoxy)propane-1,2,3-tricarboxylate (PubChem CID 139655837) has the molecular formula C27H44O7 and a molecular weight of 480.64 g/mol. Its IUPAC name is triethyl 1-(3,7,11-trimethyldodeca-2,6,10-trienoxy)propane-1,2,3-tricarboxylate.
| Compound Name | triethyl 1-(3,7,11-trimethyldodeca-2,6,10-trienoxy)propane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 139655837 |
| Molecular Formula | C27H44O7 |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | triethyl 1-(3,7,11-trimethyldodeca-2,6,10-trienoxy)propane-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)CC(C(=O)OCC)C(OCC=C(C)CCC=C(C)CCC=C(C)C)C(=O)OCC |
| InChI | InChI=1S/C27H44O7/c1-8-31-24(28)19-23(26(29)32-9-2)25(27(30)33-10-3)34-18-17-22(7)16-12-15-21(6)14-11-13-20(4)5/h13,15,17,23,25H,8-12,14,16,18-19H2,1-7H3 |
| InChIKey | DSPNJJTXVCXNHV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|