C25H38O7 — CID 139655892
diethyl 5-oxo-4-(3,7,11-trimethyldodeca-2,6,10-trienoxy)oxolane-2,3-dicarboxylate (PubChem CID 139655892) has the molecular formula C25H38O7 and a molecular weight of 450.57 g/mol. Its IUPAC name is diethyl 5-oxo-4-(3,7,11-trimethyldodeca-2,6,10-trienoxy)oxolane-2,3-dicarboxylate.
| Compound Name | diethyl 5-oxo-4-(3,7,11-trimethyldodeca-2,6,10-trienoxy)oxolane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 139655892 |
| Molecular Formula | C25H38O7 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | diethyl 5-oxo-4-(3,7,11-trimethyldodeca-2,6,10-trienoxy)oxolane-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1OC(=O)C(OCC=C(C)CCC=C(C)CCC=C(C)C)C1C(=O)OCC |
| InChI | InChI=1S/C25H38O7/c1-7-29-23(26)20-21(25(28)32-22(20)24(27)30-8-2)31-16-15-19(6)14-10-13-18(5)12-9-11-17(3)4/h11,13,15,20-22H,7-10,12,14,16H2,1-6H3 |
| InChIKey | ZKSLYWKBEDVDEW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|