C20H32Si — CID 139667900
bis(2-ethyl-3,5-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane (PubChem CID 139667900) has the molecular formula C20H32Si and a molecular weight of 300.56 g/mol. Its IUPAC name is bis(2-ethyl-3,5-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane.
| Compound Name | bis(2-ethyl-3,5-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 139667900 |
| Molecular Formula | C20H32Si |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | bis(2-ethyl-3,5-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane |
| SMILES | CCC1=C(C)C=C(C)C1[Si](C)(C)C1C(C)=CC(C)=C1CC |
| InChI | InChI=1S/C20H32Si/c1-9-17-13(3)11-15(5)19(17)21(7,8)20-16(6)12-14(4)18(20)10-2/h11-12,19-20H,9-10H2,1-8H3 |
| InChIKey | SPLMXNIEPUONDZ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|