C50H44N6O3 — CID 139671557
methyl 3-[[4-methyl-2-propyl-6-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methoxy]pyrimidin-5-yl]methyl]benzoate (PubChem CID 139671557) has the molecular formula C50H44N6O3 and a molecular weight of 776.94 g/mol. Its IUPAC name is methyl 3-[[4-methyl-2-propyl-6-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methoxy]pyrimidin-5-yl]methyl]benzoate.
| Compound Name | methyl 3-[[4-methyl-2-propyl-6-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methoxy]pyrimidin-5-yl]methyl]benzoate |
|---|---|
| PubChem CID | 139671557 |
| Molecular Formula | C50H44N6O3 |
| Molecular Weight | 776.94 g/mol |
| Exact Mass | 776.35 |
| IUPAC Name | methyl 3-[[4-methyl-2-propyl-6-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methoxy]pyrimidin-5-yl]methyl]benzoate |
| SMILES | CCCc1nc(C)c(Cc2cccc(C(=O)OC)c2)c(OCc2ccc(-c3ccccc3-c3nnnn3C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C50H44N6O3/c1-4-17-46-51-35(2)45(33-37-18-16-19-39(32-37)49(57)58-3)48(52-46)59-34-36-28-30-38(31-29-36)43-26-14-15-27-44(43)47-53-54-55-56(47)50(40-20-8-5-9-21-40,41-22-10-6-11-23-41)42-24-12-7-13-25-42/h5-16,18-32H,4,17,33-34H2,1-3H3 |
| InChIKey | ZEGLIGAJWLTRGD-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 104.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.94 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|