C27H29N3O7 — CID 139676323
(2S)-2-[(7-methoxy-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carbonyl)amino]-6-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 139676323) has the molecular formula C27H29N3O7 and a molecular weight of 507.54 g/mol. Its IUPAC name is (2S)-2-[(7-methoxy-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carbonyl)amino]-6-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | (2S)-2-[(7-methoxy-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carbonyl)amino]-6-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 139676323 |
| Molecular Formula | C27H29N3O7 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | (2S)-2-[(7-methoxy-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carbonyl)amino]-6-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | COc1ccc2c(c1)CCc1c(C(=O)N[C@@H](CCCCNC(=O)OCc3ccccc3)C(=O)O)noc1-2 |
| InChI | InChI=1S/C27H29N3O7/c1-35-19-11-13-20-18(15-19)10-12-21-23(30-37-24(20)21)25(31)29-22(26(32)33)9-5-6-14-28-27(34)36-16-17-7-3-2-4-8-17/h2-4,7-8,11,13,15,22H,5-6,9-10,12,14,16H2,1H3,(H,28,34)(H,29,31)(H,32,33)/t22-/m0/s1 |
| InChIKey | IRCLNRPOARUUMG-QFIPXVFZSA-N |
| XLogP | 3.73 |
| TPSA | 139.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|