About 1-amino-3-[[(1S,2S)-2-fluorocyclopropyl]amino]urea
1-amino-3-[[(1S,2S)-2-fluorocyclopropyl]amino]urea (PubChem CID 139683825) has the molecular formula C4H9FN4O
and a molecular weight of 148.14 g/mol. Its IUPAC name is 1-amino-3-[[(1S,2S)-2-fluorocyclopropyl]amino]urea.
Molecular Properties
| Compound Name | 1-amino-3-[[(1S,2S)-2-fluorocyclopropyl]amino]urea |
| PubChem CID | 139683825 |
| Molecular Formula | C4H9FN4O |
| Molecular Weight | 148.14 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | 1-amino-3-[[(1S,2S)-2-fluorocyclopropyl]amino]urea |
| SMILES | NNC(=O)NN[C@H]1C[C@@H]1F |
| InChI | InChI=1S/C4H9FN4O/c5-2-1-3(2)8-9-4(10)7-6/h2-3,8H,1,6H2,(H2,7,9,10)/t2-,3-/m0/s1 |
| InChIKey | UHZLUTNRQNKZQF-HRFVKAFMSA-N |
| XLogP | -1.23 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.14 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-[[(1S,2S)-2-fluorocyclopropyl]amino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-[[(1S,2S)-2-fluorocyclopropyl]amino]urea?
The IUPAC name of 1-amino-3-[[(1S,2S)-2-fluorocyclopropyl]amino]urea (CID 139683825) is 1-amino-3-[[(1S,2S)-2-fluorocyclopropyl]amino]urea.
What is the SMILES notation for 1-amino-3-[[(1S,2S)-2-fluorocyclopropyl]amino]urea?
The canonical SMILES for 1-amino-3-[[(1S,2S)-2-fluorocyclopropyl]amino]urea is NNC(=O)NN[C@H]1C[C@@H]1F.
What is the InChIKey of 1-amino-3-[[(1S,2S)-2-fluorocyclopropyl]amino]urea?
The InChIKey is UHZLUTNRQNKZQF-HRFVKAFMSA-N. The full InChI is InChI=1S/C4H9FN4O/c5-2-1-3(2)8-9-4(10)7-6/h2-3,8H,1,6H2,(H2,7,9,10)/t2-,3-/m0/s1.
What are the key properties of 1-amino-3-[[(1S,2S)-2-fluorocyclopropyl]amino]urea?
1-amino-3-[[(1S,2S)-2-fluorocyclopropyl]amino]urea has a molecular weight of 148.14 g/mol, XLogP of -1.23, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-[[(1S,2S)-2-fluorocyclopropyl]amino]urea is sourced from PubChem (CID 139683825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).