C11H21NO7S — CID 139700476
(2S)-3-deuterio-4-methylsulfanyl-2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]butanoic acid (PubChem CID 139700476) has the molecular formula C11H21NO7S and a molecular weight of 312.36 g/mol. Its IUPAC name is (2S)-3-deuterio-4-methylsulfanyl-2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]butanoic acid.
| Compound Name | (2S)-3-deuterio-4-methylsulfanyl-2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]butanoic acid |
|---|---|
| PubChem CID | 139700476 |
| Molecular Formula | C11H21NO7S |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (2S)-3-deuterio-4-methylsulfanyl-2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]butanoic acid |
| SMILES | [2H]C(CSC)[C@H](NCC(=O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=O)O |
| InChI | InChI=1S/C11H21NO7S/c1-20-3-2-6(11(18)19)12-4-7(14)9(16)10(17)8(15)5-13/h6,8-10,12-13,15-17H,2-5H2,1H3,(H,18,19)/t6-,8+,9+,10+/m0/s1/i2D/t2?,6-,8+,9+,10+ |
| InChIKey | UXCZPSDCDHUREX-AIOXHTGOSA-N |
| XLogP | -2.57 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |