C28H28F5N3O3S — CID 139707230
(2R,3R)-2-(2,4-difluorophenyl)-1-(triazol-1-yl)-3-[[2-[(2E,4E)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-2-yl]-1,3-dioxan-5-yl]sulfanyl]butan-2-ol (PubChem CID 139707230) has the molecular formula C28H28F5N3O3S and a molecular weight of 581.61 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-1-(triazol-1-yl)-3-[[2-[(2E,4E)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-2-yl]-1,3-dioxan-5-yl]sulfanyl]butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-1-(triazol-1-yl)-3-[[2-[(2E,4E)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-2-yl]-1,3-dioxan-5-yl]sulfanyl]butan-2-ol |
|---|---|
| PubChem CID | 139707230 |
| Molecular Formula | C28H28F5N3O3S |
| Molecular Weight | 581.61 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-1-(triazol-1-yl)-3-[[2-[(2E,4E)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dien-2-yl]-1,3-dioxan-5-yl]sulfanyl]butan-2-ol |
| SMILES | C/C(=C\C=C\c1ccc(C(F)(F)F)cc1)C1OCC(S[C@H](C)[C@](O)(Cn2ccnn2)c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C28H28F5N3O3S/c1-18(4-3-5-20-6-8-21(9-7-20)28(31,32)33)26-38-15-23(16-39-26)40-19(2)27(37,17-36-13-12-34-35-36)24-11-10-22(29)14-25(24)30/h3-14,19,23,26,37H,15-17H2,1-2H3/b5-3+,18-4+/t19-,23?,26?,27-/m1/s1 |
| InChIKey | KUNOMDQHDJNEOP-DRCITGQISA-N |
| XLogP | 5.99 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.61 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|