C43H42O10 — CID 139754725
bis(2-phenylpropan-2-yl) 5-[4-(2-phenylpropan-2-ylperoxycarbonyl)benzoyl]cyclohexa-2,4-diene-1,1-dicarboperoxoate (PubChem CID 139754725) has the molecular formula C43H42O10 and a molecular weight of 718.80 g/mol. Its IUPAC name is bis(2-phenylpropan-2-yl) 5-[4-(2-phenylpropan-2-ylperoxycarbonyl)benzoyl]cyclohexa-2,4-diene-1,1-dicarboperoxoate.
| Compound Name | bis(2-phenylpropan-2-yl) 5-[4-(2-phenylpropan-2-ylperoxycarbonyl)benzoyl]cyclohexa-2,4-diene-1,1-dicarboperoxoate |
|---|---|
| PubChem CID | 139754725 |
| Molecular Formula | C43H42O10 |
| Molecular Weight | 718.80 g/mol |
| Exact Mass | 718.28 |
| IUPAC Name | bis(2-phenylpropan-2-yl) 5-[4-(2-phenylpropan-2-ylperoxycarbonyl)benzoyl]cyclohexa-2,4-diene-1,1-dicarboperoxoate |
| SMILES | CC(C)(OOC(=O)c1ccc(C(=O)C2=CC=CC(C(=O)OOC(C)(C)c3ccccc3)(C(=O)OOC(C)(C)c3ccccc3)C2)cc1)c1ccccc1 |
| InChI | InChI=1S/C43H42O10/c1-40(2,33-18-10-7-11-19-33)51-48-37(45)31-26-24-30(25-27-31)36(44)32-17-16-28-43(29-32,38(46)49-52-41(3,4)34-20-12-8-13-21-34)39(47)50-53-42(5,6)35-22-14-9-15-23-35/h7-28H,29H2,1-6H3 |
| InChIKey | TURFXZKFHAWGCB-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.80 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|