C25H28O11 — CID 21289218
1-tert-butylperoxycarbonyl-5-(4-tert-butylperoxycarbonylbenzoyl)cyclohexa-2,4-diene-1,2-dicarboxylic acid (PubChem CID 21289218) has the molecular formula C25H28O11 and a molecular weight of 504.49 g/mol. Its IUPAC name is 1-tert-butylperoxycarbonyl-5-(4-tert-butylperoxycarbonylbenzoyl)cyclohexa-2,4-diene-1,2-dicarboxylic acid.
| Compound Name | 1-tert-butylperoxycarbonyl-5-(4-tert-butylperoxycarbonylbenzoyl)cyclohexa-2,4-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 21289218 |
| Molecular Formula | C25H28O11 |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 1-tert-butylperoxycarbonyl-5-(4-tert-butylperoxycarbonylbenzoyl)cyclohexa-2,4-diene-1,2-dicarboxylic acid |
| SMILES | CC(C)(C)OOC(=O)c1ccc(C(=O)C2=CC=C(C(=O)O)C(C(=O)O)(C(=O)OOC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C25H28O11/c1-23(2,3)35-33-20(29)15-9-7-14(8-10-15)18(26)16-11-12-17(19(27)28)25(13-16,21(30)31)22(32)34-36-24(4,5)6/h7-12H,13H2,1-6H3,(H,27,28)(H,30,31) |
| InChIKey | RALCPJLIGKAJAF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|