C12H15ClF3NO3S — CID 139756478
[3-chloro-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]-2-pyridinyl]methanol (PubChem CID 139756478) has the molecular formula C12H15ClF3NO3S and a molecular weight of 345.77 g/mol. Its IUPAC name is [3-chloro-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]-2-pyridinyl]methanol.
| Compound Name | [3-chloro-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 139756478 |
| Molecular Formula | C12H15ClF3NO3S |
| Molecular Weight | 345.77 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | [3-chloro-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]-2-pyridinyl]methanol |
| SMILES | OCc1nccc(SCCOCCOCC(F)(F)F)c1Cl |
| InChI | InChI=1S/C12H15ClF3NO3S/c13-11-9(7-18)17-2-1-10(11)21-6-5-19-3-4-20-8-12(14,15)16/h1-2,18H,3-8H2 |
| InChIKey | QLPSDJRKRDQHEE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.77 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|