C15H35N3O3Si4 — CID 139757081
2-tris(trimethylsilyloxy)silylbenzene-1,3,5-triamine (PubChem CID 139757081) has the molecular formula C15H35N3O3Si4 and a molecular weight of 417.81 g/mol. Its IUPAC name is 2-tris(trimethylsilyloxy)silylbenzene-1,3,5-triamine.
| Compound Name | 2-tris(trimethylsilyloxy)silylbenzene-1,3,5-triamine |
|---|---|
| PubChem CID | 139757081 |
| Molecular Formula | C15H35N3O3Si4 |
| Molecular Weight | 417.81 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 2-tris(trimethylsilyloxy)silylbenzene-1,3,5-triamine |
| SMILES | C[Si](C)(C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)c1c(N)cc(N)cc1N |
| InChI | InChI=1S/C15H35N3O3Si4/c1-22(2,3)19-25(20-23(4,5)6,21-24(7,8)9)15-13(17)10-12(16)11-14(15)18/h10-11H,16-18H2,1-9H3 |
| InChIKey | LSUXXGHMRJJAMM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.81 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|