C18H24N2O4 — CID 139771104
N,N-dimethyl-4-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydro-2,1-benzoxazol-3-amine (PubChem CID 139771104) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is N,N-dimethyl-4-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydro-2,1-benzoxazol-3-amine.
| Compound Name | N,N-dimethyl-4-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydro-2,1-benzoxazol-3-amine |
|---|---|
| PubChem CID | 139771104 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N,N-dimethyl-4-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydro-2,1-benzoxazol-3-amine |
| SMILES | COc1cc(C2CCCc3noc(N(C)C)c32)cc(OC)c1OC |
| InChI | InChI=1S/C18H24N2O4/c1-20(2)18-16-12(7-6-8-13(16)19-24-18)11-9-14(21-3)17(23-5)15(10-11)22-4/h9-10,12H,6-8H2,1-5H3 |
| InChIKey | WZAMNAKMHGIEBE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 56.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |