C26H40N2O8 — CID 139789331
bis(1,3-dihydroxy-2,2,6,6-tetramethylpiperidin-4-yl) benzene-1,2-dicarboxylate (PubChem CID 139789331) has the molecular formula C26H40N2O8 and a molecular weight of 508.61 g/mol. Its IUPAC name is bis(1,3-dihydroxy-2,2,6,6-tetramethylpiperidin-4-yl) benzene-1,2-dicarboxylate.
| Compound Name | bis(1,3-dihydroxy-2,2,6,6-tetramethylpiperidin-4-yl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139789331 |
| Molecular Formula | C26H40N2O8 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | bis(1,3-dihydroxy-2,2,6,6-tetramethylpiperidin-4-yl) benzene-1,2-dicarboxylate |
| SMILES | CC1(C)CC(OC(=O)c2ccccc2C(=O)OC2CC(C)(C)N(O)C(C)(C)C2O)C(O)C(C)(C)N1O |
| InChI | InChI=1S/C26H40N2O8/c1-23(2)13-17(19(29)25(5,6)27(23)33)35-21(31)15-11-9-10-12-16(15)22(32)36-18-14-24(3,4)28(34)26(7,8)20(18)30/h9-12,17-20,29-30,33-34H,13-14H2,1-8H3 |
| InChIKey | WOOIDPKZHSQPLY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |