C21H24ClFN2O5 — CID 139799485
diethyl 2-[[3-chloro-N-cyclopropyl-4-fluoro-2-methyl-5-(prop-2-enoylamino)anilino]methylidene]propanedioate (PubChem CID 139799485) has the molecular formula C21H24ClFN2O5 and a molecular weight of 438.88 g/mol. Its IUPAC name is diethyl 2-[[3-chloro-N-cyclopropyl-4-fluoro-2-methyl-5-(prop-2-enoylamino)anilino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[3-chloro-N-cyclopropyl-4-fluoro-2-methyl-5-(prop-2-enoylamino)anilino]methylidene]propanedioate |
|---|---|
| PubChem CID | 139799485 |
| Molecular Formula | C21H24ClFN2O5 |
| Molecular Weight | 438.88 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | diethyl 2-[[3-chloro-N-cyclopropyl-4-fluoro-2-methyl-5-(prop-2-enoylamino)anilino]methylidene]propanedioate |
| SMILES | C=CC(=O)Nc1cc(N(C=C(C(=O)OCC)C(=O)OCC)C2CC2)c(C)c(Cl)c1F |
| InChI | InChI=1S/C21H24ClFN2O5/c1-5-17(26)24-15-10-16(12(4)18(22)19(15)23)25(13-8-9-13)11-14(20(27)29-6-2)21(28)30-7-3/h5,10-11,13H,1,6-9H2,2-4H3,(H,24,26) |
| InChIKey | UIENIOPUUNUKRU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.88 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|