C16H16ClF2NO3 — CID 173401335
ethyl 2-amino-3-[2-(2-chloro-3,5-difluoro-4-methylbenzoyl)cyclopropyl]prop-2-enoate (PubChem CID 173401335) has the molecular formula C16H16ClF2NO3 and a molecular weight of 343.76 g/mol. Its IUPAC name is ethyl 2-amino-3-[2-(2-chloro-3,5-difluoro-4-methylbenzoyl)cyclopropyl]prop-2-enoate.
| Compound Name | ethyl 2-amino-3-[2-(2-chloro-3,5-difluoro-4-methylbenzoyl)cyclopropyl]prop-2-enoate |
|---|---|
| PubChem CID | 173401335 |
| Molecular Formula | C16H16ClF2NO3 |
| Molecular Weight | 343.76 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | ethyl 2-amino-3-[2-(2-chloro-3,5-difluoro-4-methylbenzoyl)cyclopropyl]prop-2-enoate |
| SMILES | CCOC(=O)C(N)=CC1CC1C(=O)c1cc(F)c(C)c(F)c1Cl |
| InChI | InChI=1S/C16H16ClF2NO3/c1-3-23-16(22)12(20)5-8-4-9(8)15(21)10-6-11(18)7(2)14(19)13(10)17/h5-6,8-9H,3-4,20H2,1-2H3 |
| InChIKey | MSAKHSNUTYMGNA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.76 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|