C22H44O2 — CID 139830040
3-(5,8-ditert-butyl-8-methyldodecan-5-yl)dioxirane (PubChem CID 139830040) has the molecular formula C22H44O2 and a molecular weight of 340.59 g/mol. Its IUPAC name is 3-(5,8-ditert-butyl-8-methyldodecan-5-yl)dioxirane.
| Compound Name | 3-(5,8-ditert-butyl-8-methyldodecan-5-yl)dioxirane |
|---|---|
| PubChem CID | 139830040 |
| Molecular Formula | C22H44O2 |
| Molecular Weight | 340.59 g/mol |
| Exact Mass | 340.33 |
| IUPAC Name | 3-(5,8-ditert-butyl-8-methyldodecan-5-yl)dioxirane |
| SMILES | CCCCC(C)(CCC(CCCC)(C1OO1)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C22H44O2/c1-10-12-14-21(9,19(3,4)5)16-17-22(15-13-11-2,18-23-24-18)20(6,7)8/h18H,10-17H2,1-9H3 |
| InChIKey | VTWFRPWCGLISNO-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.59 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|