C17H20ClOP — CID 139838781
3-phenyl-4,5-di(propan-2-yl)-1H-phosphole-2-carbonyl chloride (PubChem CID 139838781) has the molecular formula C17H20ClOP and a molecular weight of 306.77 g/mol. Its IUPAC name is 3-phenyl-4,5-di(propan-2-yl)-1H-phosphole-2-carbonyl chloride.
| Compound Name | 3-phenyl-4,5-di(propan-2-yl)-1H-phosphole-2-carbonyl chloride |
|---|---|
| PubChem CID | 139838781 |
| Molecular Formula | C17H20ClOP |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 3-phenyl-4,5-di(propan-2-yl)-1H-phosphole-2-carbonyl chloride |
| SMILES | CC(C)c1[pH]c(C(=O)Cl)c(-c2ccccc2)c1C(C)C |
| InChI | InChI=1S/C17H20ClOP/c1-10(2)13-14(12-8-6-5-7-9-12)16(17(18)19)20-15(13)11(3)4/h5-11,20H,1-4H3 |
| InChIKey | BSXLEURPQGVGHN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|