C16H13FO4 — CID 139885712
1-(2-fluoro-6-hydroxy-4-phenoxyphenyl)butane-1,3-dione (PubChem CID 139885712) has the molecular formula C16H13FO4 and a molecular weight of 288.27 g/mol. Its IUPAC name is 1-(2-fluoro-6-hydroxy-4-phenoxyphenyl)butane-1,3-dione.
| Compound Name | 1-(2-fluoro-6-hydroxy-4-phenoxyphenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 139885712 |
| Molecular Formula | C16H13FO4 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 1-(2-fluoro-6-hydroxy-4-phenoxyphenyl)butane-1,3-dione |
| SMILES | CC(=O)CC(=O)c1c(O)cc(Oc2ccccc2)cc1F |
| InChI | InChI=1S/C16H13FO4/c1-10(18)7-14(19)16-13(17)8-12(9-15(16)20)21-11-5-3-2-4-6-11/h2-6,8-9,20H,7H2,1H3 |
| InChIKey | GZDVRGVCSNDBKU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|