C22H28ClNO3S — CID 139891195
butyl-[2-hydroxy-3-(9-oxothioxanthen-2-yl)oxypropyl]-dimethylazanium chloride (PubChem CID 139891195) has the molecular formula C22H28ClNO3S and a molecular weight of 421.99 g/mol. Its IUPAC name is butyl-[2-hydroxy-3-(9-oxothioxanthen-2-yl)oxypropyl]-dimethylazanium chloride.
| Compound Name | butyl-[2-hydroxy-3-(9-oxothioxanthen-2-yl)oxypropyl]-dimethylazanium chloride |
|---|---|
| PubChem CID | 139891195 |
| Molecular Formula | C22H28ClNO3S |
| Molecular Weight | 421.99 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | butyl-[2-hydroxy-3-(9-oxothioxanthen-2-yl)oxypropyl]-dimethylazanium chloride |
| SMILES | CCCC[N+](C)(C)CC(O)COc1ccc2sc3ccccc3c(=O)c2c1.[Cl-] |
| InChI | InChI=1S/C22H28NO3S.ClH/c1-4-5-12-23(2,3)14-16(24)15-26-17-10-11-21-19(13-17)22(25)18-8-6-7-9-20(18)27-21;/h6-11,13,16,24H,4-5,12,14-15H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | ITVYLUCIMGSRKX-UHFFFAOYSA-M |
| XLogP | 1.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.99 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|