C23H30NO6PS — CID 140743462
3-[diethyl-[3-(9-oxothioxanthen-2-yl)oxypropyl]azaniumyl]propyl hydrogen phosphate (PubChem CID 140743462) has the molecular formula C23H30NO6PS and a molecular weight of 479.54 g/mol. Its IUPAC name is 3-[diethyl-[3-(9-oxothioxanthen-2-yl)oxypropyl]azaniumyl]propyl hydrogen phosphate.
| Compound Name | 3-[diethyl-[3-(9-oxothioxanthen-2-yl)oxypropyl]azaniumyl]propyl hydrogen phosphate |
|---|---|
| PubChem CID | 140743462 |
| Molecular Formula | C23H30NO6PS |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 3-[diethyl-[3-(9-oxothioxanthen-2-yl)oxypropyl]azaniumyl]propyl hydrogen phosphate |
| SMILES | CC[N+](CC)(CCCOc1ccc2sc3ccccc3c(=O)c2c1)CCCOP(=O)([O-])O |
| InChI | InChI=1S/C23H30NO6PS/c1-3-24(4-2,14-8-16-30-31(26,27)28)13-7-15-29-18-11-12-22-20(17-18)23(25)19-9-5-6-10-21(19)32-22/h5-6,9-12,17H,3-4,7-8,13-16H2,1-2H3,(H-,26,27,28) |
| InChIKey | YBJANVKQLCAEOH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|