C40H49NO7 — CID 139892977
(2R,3R)-3-[5-(3,4-dimethylphenyl)pentoxy]-2-hydroxy-4-[5-(6-methoxynaphthalen-2-yl)pentyl-phenylmethoxyamino]-4-oxobutanoic acid (PubChem CID 139892977) has the molecular formula C40H49NO7 and a molecular weight of 655.83 g/mol. Its IUPAC name is (2R,3R)-3-[5-(3,4-dimethylphenyl)pentoxy]-2-hydroxy-4-[5-(6-methoxynaphthalen-2-yl)pentyl-phenylmethoxyamino]-4-oxobutanoic acid.
| Compound Name | (2R,3R)-3-[5-(3,4-dimethylphenyl)pentoxy]-2-hydroxy-4-[5-(6-methoxynaphthalen-2-yl)pentyl-phenylmethoxyamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139892977 |
| Molecular Formula | C40H49NO7 |
| Molecular Weight | 655.83 g/mol |
| Exact Mass | 655.35 |
| IUPAC Name | (2R,3R)-3-[5-(3,4-dimethylphenyl)pentoxy]-2-hydroxy-4-[5-(6-methoxynaphthalen-2-yl)pentyl-phenylmethoxyamino]-4-oxobutanoic acid |
| SMILES | COc1ccc2cc(CCCCCN(OCc3ccccc3)C(=O)[C@H](OCCCCCc3ccc(C)c(C)c3)[C@@H](O)C(=O)O)ccc2c1 |
| InChI | InChI=1S/C40H49NO7/c1-29-17-18-31(25-30(29)2)13-10-6-12-24-47-38(37(42)40(44)45)39(43)41(48-28-33-15-7-4-8-16-33)23-11-5-9-14-32-19-20-35-27-36(46-3)22-21-34(35)26-32/h4,7-8,15-22,25-27,37-38,42H,5-6,9-14,23-24,28H2,1-3H3,(H,44,45)/t37-,38-/m1/s1 |
| InChIKey | KUAPKLBLAJARBS-XPSQVAKYSA-N |
| XLogP | 7.38 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.83 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|