C31H43NO6 — CID 139893071
3-[5-(3,4-dimethylphenyl)pentoxy]-2-hydroxy-4-[5-(3-methoxyphenyl)hex-4-enyl-methylamino]-4-oxobutanoic acid (PubChem CID 139893071) has the molecular formula C31H43NO6 and a molecular weight of 525.69 g/mol. Its IUPAC name is 3-[5-(3,4-dimethylphenyl)pentoxy]-2-hydroxy-4-[5-(3-methoxyphenyl)hex-4-enyl-methylamino]-4-oxobutanoic acid.
| Compound Name | 3-[5-(3,4-dimethylphenyl)pentoxy]-2-hydroxy-4-[5-(3-methoxyphenyl)hex-4-enyl-methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139893071 |
| Molecular Formula | C31H43NO6 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.31 |
| IUPAC Name | 3-[5-(3,4-dimethylphenyl)pentoxy]-2-hydroxy-4-[5-(3-methoxyphenyl)hex-4-enyl-methylamino]-4-oxobutanoic acid |
| SMILES | COc1cccc(C(C)=CCCCN(C)C(=O)C(OCCCCCc2ccc(C)c(C)c2)C(O)C(=O)O)c1 |
| InChI | InChI=1S/C31H43NO6/c1-22-16-17-25(20-24(22)3)13-7-6-10-19-38-29(28(33)31(35)36)30(34)32(4)18-9-8-12-23(2)26-14-11-15-27(21-26)37-5/h11-12,14-17,20-21,28-29,33H,6-10,13,18-19H2,1-5H3,(H,35,36) |
| InChIKey | AUDSZOJTEJYWAZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|