C36H56ClN2O5Si — CID 67580790
CID 67580790 (PubChem CID 67580790) has the molecular formula C36H56ClN2O5Si and a molecular weight of 660.39 g/mol.
| Compound Name | CID 67580790 |
|---|---|
| PubChem CID | 67580790 |
| Molecular Formula | C36H56ClN2O5Si |
| Molecular Weight | 660.39 g/mol |
| Exact Mass | 659.36 |
| IUPAC Name | — |
| SMILES | Cc1ccc(CCCCCO[C@@H](C(=O)N(C)CCCCCNc2ccc(C)c(Cl)c2)[C@@](O[Si](C)C)(C(=O)O)C(C)(C)C)cc1C |
| InChI | InChI=1S/C36H56ClN2O5Si/c1-26-17-19-29(24-28(26)3)16-12-10-15-23-43-32(36(34(41)42,35(4,5)6)44-45(8)9)33(40)39(7)22-14-11-13-21-38-30-20-18-27(2)31(37)25-30/h17-20,24-25,32,38H,10-16,21-23H2,1-9H3,(H,41,42)/t32-,36+/m0/s1 |
| InChIKey | HQQXQSPJVNRTTQ-LBHUVFDKSA-N |
| XLogP | 8.24 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.39 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|