C18H22Cl3N5O2 — CID 139894217
N-[4-[2-(3,4-dimethoxyphenyl)ethenyl]-6-(trichloromethyl)-1,3,5-triazin-2-yl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 139894217) has the molecular formula C18H22Cl3N5O2 and a molecular weight of 446.77 g/mol. Its IUPAC name is N-[4-[2-(3,4-dimethoxyphenyl)ethenyl]-6-(trichloromethyl)-1,3,5-triazin-2-yl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[4-[2-(3,4-dimethoxyphenyl)ethenyl]-6-(trichloromethyl)-1,3,5-triazin-2-yl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 139894217 |
| Molecular Formula | C18H22Cl3N5O2 |
| Molecular Weight | 446.77 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | N-[4-[2-(3,4-dimethoxyphenyl)ethenyl]-6-(trichloromethyl)-1,3,5-triazin-2-yl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | COc1ccc(C=Cc2nc(NCCN(C)C)nc(C(Cl)(Cl)Cl)n2)cc1OC |
| InChI | InChI=1S/C18H22Cl3N5O2/c1-26(2)10-9-22-17-24-15(23-16(25-17)18(19,20)21)8-6-12-5-7-13(27-3)14(11-12)28-4/h5-8,11H,9-10H2,1-4H3,(H,22,23,24,25) |
| InChIKey | AFZKLXQFDFKELW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.77 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|