C21H26O10S2 — CID 139917500
[(2R,3S,4S,5R)-6-deuterio-3,4,5-trihydroxy-5-[(4-methylphenyl)sulfonyloxymethyl]oxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 139917500) has the molecular formula C21H26O10S2 and a molecular weight of 503.57 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-6-deuterio-3,4,5-trihydroxy-5-[(4-methylphenyl)sulfonyloxymethyl]oxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,4S,5R)-6-deuterio-3,4,5-trihydroxy-5-[(4-methylphenyl)sulfonyloxymethyl]oxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139917500 |
| Molecular Formula | C21H26O10S2 |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | [(2R,3S,4S,5R)-6-deuterio-3,4,5-trihydroxy-5-[(4-methylphenyl)sulfonyloxymethyl]oxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | [2H]C1O[C@H](COS(=O)(=O)c2ccc(C)cc2)[C@@H](O)[C@H](O)[C@]1(O)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H26O10S2/c1-14-3-7-16(8-4-14)32(25,26)30-11-18-19(22)20(23)21(24,12-29-18)13-31-33(27,28)17-9-5-15(2)6-10-17/h3-10,18-20,22-24H,11-13H2,1-2H3/t18-,19-,20+,21-/m1/s1/i12D/t12?,18-,19-,20+,21- |
| InChIKey | LFNUXMVTJVEZBI-OAQVHCHHSA-N |
| XLogP | 0.27 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|