C6H7NO3S — CID 139939157
(2R)-2-(prop-2-ynoylamino)-3-sulfanylpropanoic acid (PubChem CID 139939157) has the molecular formula C6H7NO3S and a molecular weight of 173.19 g/mol. Its IUPAC name is (2R)-2-(prop-2-ynoylamino)-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-(prop-2-ynoylamino)-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 139939157 |
| Molecular Formula | C6H7NO3S |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | (2R)-2-(prop-2-ynoylamino)-3-sulfanylpropanoic acid |
| SMILES | C#CC(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C6H7NO3S/c1-2-5(8)7-4(3-11)6(9)10/h1,4,11H,3H2,(H,7,8)(H,9,10)/t4-/m0/s1 |
| InChIKey | QUWGMUBVOBIMEV-BYPYZUCNSA-N |
| XLogP | -0.88 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|