C13H22ClN3O10 — CID 139949490
1-(2-chloroethyl)-1-nitroso-3,3-bis(1,2,2,3-tetrahydroxycyclopentyl)urea (PubChem CID 139949490) has the molecular formula C13H22ClN3O10 and a molecular weight of 415.78 g/mol. Its IUPAC name is 1-(2-chloroethyl)-1-nitroso-3,3-bis(1,2,2,3-tetrahydroxycyclopentyl)urea.
| Compound Name | 1-(2-chloroethyl)-1-nitroso-3,3-bis(1,2,2,3-tetrahydroxycyclopentyl)urea |
|---|---|
| PubChem CID | 139949490 |
| Molecular Formula | C13H22ClN3O10 |
| Molecular Weight | 415.78 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 1-(2-chloroethyl)-1-nitroso-3,3-bis(1,2,2,3-tetrahydroxycyclopentyl)urea |
| SMILES | O=NN(CCCl)C(=O)N(C1(O)CCC(O)C1(O)O)C1(O)CCC(O)C1(O)O |
| InChI | InChI=1S/C13H22ClN3O10/c14-5-6-16(15-27)9(20)17(10(21)3-1-7(18)12(10,23)24)11(22)4-2-8(19)13(11,25)26/h7-8,18-19,21-26H,1-6H2 |
| InChIKey | BNIZKKAIOITPRE-UHFFFAOYSA-N |
| XLogP | -3.32 |
| TPSA | 214.82 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.78 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|