C15H24 — CID 139973453
3-ethylidene-1-methyl-1-(4-methylpenta-1,3-dienyl)cyclohexane (PubChem CID 139973453) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is 3-ethylidene-1-methyl-1-(4-methylpenta-1,3-dienyl)cyclohexane.
| Compound Name | 3-ethylidene-1-methyl-1-(4-methylpenta-1,3-dienyl)cyclohexane |
|---|---|
| PubChem CID | 139973453 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 3-ethylidene-1-methyl-1-(4-methylpenta-1,3-dienyl)cyclohexane |
| SMILES | CC=C1CCCC(C)(C=CC=C(C)C)C1 |
| InChI | InChI=1S/C15H24/c1-5-14-9-7-11-15(4,12-14)10-6-8-13(2)3/h5-6,8,10H,7,9,11-12H2,1-4H3 |
| InChIKey | OKYCZJMZIKCJMX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|