C19H28N2O3 — CID 139988511
benzyl 2-[(E)-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminomethyl]-2-methylbutanoate (PubChem CID 139988511) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is benzyl 2-[(E)-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminomethyl]-2-methylbutanoate.
| Compound Name | benzyl 2-[(E)-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminomethyl]-2-methylbutanoate |
|---|---|
| PubChem CID | 139988511 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | benzyl 2-[(E)-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminomethyl]-2-methylbutanoate |
| SMILES | CCC(C)(/C=N/N1CCC[C@H]1COC)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H28N2O3/c1-4-19(2,15-20-21-12-8-11-17(21)14-23-3)18(22)24-13-16-9-6-5-7-10-16/h5-7,9-10,15,17H,4,8,11-14H2,1-3H3/b20-15+/t17-,19?/m0/s1 |
| InChIKey | XRQVZQBGRXWPMD-JSEKLIEYSA-N |
| XLogP | 3.24 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|