C20H42O6Si2 — CID 139989335
dipropyl 2,3-diethyl-2,3-bis(trimethylsilyloxy)butanedioate (PubChem CID 139989335) has the molecular formula C20H42O6Si2 and a molecular weight of 434.72 g/mol. Its IUPAC name is dipropyl 2,3-diethyl-2,3-bis(trimethylsilyloxy)butanedioate.
| Compound Name | dipropyl 2,3-diethyl-2,3-bis(trimethylsilyloxy)butanedioate |
|---|---|
| PubChem CID | 139989335 |
| Molecular Formula | C20H42O6Si2 |
| Molecular Weight | 434.72 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | dipropyl 2,3-diethyl-2,3-bis(trimethylsilyloxy)butanedioate |
| SMILES | CCCOC(=O)C(CC)(O[Si](C)(C)C)C(CC)(O[Si](C)(C)C)C(=O)OCCC |
| InChI | InChI=1S/C20H42O6Si2/c1-11-15-23-17(21)19(13-3,25-27(5,6)7)20(14-4,26-28(8,9)10)18(22)24-16-12-2/h11-16H2,1-10H3 |
| InChIKey | MMDCFOHMFRJIND-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.72 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|