C22H46O6Si2 — CID 139989273
bis(2-methylpropyl) 2,3-diethyl-2,3-bis(trimethylsilyloxy)butanedioate (PubChem CID 139989273) has the molecular formula C22H46O6Si2 and a molecular weight of 462.78 g/mol. Its IUPAC name is bis(2-methylpropyl) 2,3-diethyl-2,3-bis(trimethylsilyloxy)butanedioate.
| Compound Name | bis(2-methylpropyl) 2,3-diethyl-2,3-bis(trimethylsilyloxy)butanedioate |
|---|---|
| PubChem CID | 139989273 |
| Molecular Formula | C22H46O6Si2 |
| Molecular Weight | 462.78 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | bis(2-methylpropyl) 2,3-diethyl-2,3-bis(trimethylsilyloxy)butanedioate |
| SMILES | CCC(O[Si](C)(C)C)(C(=O)OCC(C)C)C(CC)(O[Si](C)(C)C)C(=O)OCC(C)C |
| InChI | InChI=1S/C22H46O6Si2/c1-13-21(27-29(7,8)9,19(23)25-15-17(3)4)22(14-2,28-30(10,11)12)20(24)26-16-18(5)6/h17-18H,13-16H2,1-12H3 |
| InChIKey | RDPZJYOOYKUWTJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.78 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|