C25H54O5Si3 — CID 91696672
bis[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxy-2-propan-2-ylbutanedioate (PubChem CID 91696672) has the molecular formula C25H54O5Si3 and a molecular weight of 518.96 g/mol. Its IUPAC name is bis[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxy-2-propan-2-ylbutanedioate.
| Compound Name | bis[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxy-2-propan-2-ylbutanedioate |
|---|---|
| PubChem CID | 91696672 |
| Molecular Formula | C25H54O5Si3 |
| Molecular Weight | 518.96 g/mol |
| Exact Mass | 518.33 |
| IUPAC Name | bis[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxy-2-propan-2-ylbutanedioate |
| SMILES | CC(C)C(CC(=O)O[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H54O5Si3/c1-19(2)25(30-33(16,17)24(9,10)11,21(27)29-32(14,15)23(6,7)8)18-20(26)28-31(12,13)22(3,4)5/h19H,18H2,1-17H3 |
| InChIKey | MSHNLBZIWHIORN-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.96 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|