C22H46O6Si2 — CID 139989296
ditert-butyl 2,3-diethyl-2,3-bis(trimethylsilyloxy)butanedioate (PubChem CID 139989296) has the molecular formula C22H46O6Si2 and a molecular weight of 462.78 g/mol. Its IUPAC name is ditert-butyl 2,3-diethyl-2,3-bis(trimethylsilyloxy)butanedioate.
| Compound Name | ditert-butyl 2,3-diethyl-2,3-bis(trimethylsilyloxy)butanedioate |
|---|---|
| PubChem CID | 139989296 |
| Molecular Formula | C22H46O6Si2 |
| Molecular Weight | 462.78 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | ditert-butyl 2,3-diethyl-2,3-bis(trimethylsilyloxy)butanedioate |
| SMILES | CCC(O[Si](C)(C)C)(C(=O)OC(C)(C)C)C(CC)(O[Si](C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H46O6Si2/c1-15-21(27-29(9,10)11,17(23)25-19(3,4)5)22(16-2,28-30(12,13)14)18(24)26-20(6,7)8/h15-16H2,1-14H3 |
| InChIKey | KUXKEBDMEJVJJA-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.78 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|