C24H50O6Si2 — CID 139989373
dipentyl 2,3-diethyl-2,3-bis(trimethylsilyloxy)butanedioate (PubChem CID 139989373) has the molecular formula C24H50O6Si2 and a molecular weight of 490.83 g/mol. Its IUPAC name is dipentyl 2,3-diethyl-2,3-bis(trimethylsilyloxy)butanedioate.
| Compound Name | dipentyl 2,3-diethyl-2,3-bis(trimethylsilyloxy)butanedioate |
|---|---|
| PubChem CID | 139989373 |
| Molecular Formula | C24H50O6Si2 |
| Molecular Weight | 490.83 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | dipentyl 2,3-diethyl-2,3-bis(trimethylsilyloxy)butanedioate |
| SMILES | CCCCCOC(=O)C(CC)(O[Si](C)(C)C)C(CC)(O[Si](C)(C)C)C(=O)OCCCCC |
| InChI | InChI=1S/C24H50O6Si2/c1-11-15-17-19-27-21(25)23(13-3,29-31(5,6)7)24(14-4,30-32(8,9)10)22(26)28-20-18-16-12-2/h11-20H2,1-10H3 |
| InChIKey | ZRWGKUHJSNMOFD-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.83 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|