C37H23ClF12O5S3 — CID 139989894
[[4-(2-benzoyl-3-chlorophenyl)sulfanylphenyl]-(4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 139989894) has the molecular formula C37H23ClF12O5S3 and a molecular weight of 907.22 g/mol. Its IUPAC name is [[4-(2-benzoyl-3-chlorophenyl)sulfanylphenyl]-(4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [[4-(2-benzoyl-3-chlorophenyl)sulfanylphenyl]-(4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 139989894 |
| Molecular Formula | C37H23ClF12O5S3 |
| Molecular Weight | 907.22 g/mol |
| Exact Mass | 906.02 |
| IUPAC Name | [[4-(2-benzoyl-3-chlorophenyl)sulfanylphenyl]-(4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | COc1ccc(S(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c2ccc(Sc3cccc(Cl)c3C(=O)c3ccccc3)cc2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C37H23ClF12O5S3/c1-54-24-12-18-27(19-13-24)57(26-16-10-23(11-17-26)33(39,40)41,55-58(52,53)37(49,50)35(44,45)34(42,43)36(46,47)48)28-20-14-25(15-21-28)56-30-9-5-8-29(38)31(30)32(51)22-6-3-2-4-7-22/h2-21H,1H3 |
| InChIKey | AVBIHSYKTSNYFP-UHFFFAOYSA-N |
| XLogP | 12.72 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.22 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|