C10H16N2O3 — CID 139994419
3-(1,6-diaminohexyl)furan-2,5-dione (PubChem CID 139994419) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 3-(1,6-diaminohexyl)furan-2,5-dione.
| Compound Name | 3-(1,6-diaminohexyl)furan-2,5-dione |
|---|---|
| PubChem CID | 139994419 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 3-(1,6-diaminohexyl)furan-2,5-dione |
| SMILES | NCCCCCC(N)C1=CC(=O)OC1=O |
| InChI | InChI=1S/C10H16N2O3/c11-5-3-1-2-4-8(12)7-6-9(13)15-10(7)14/h6,8H,1-5,11-12H2 |
| InChIKey | UOOGONVEDZRTCP-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|