C33H35N3O5 — CID 139998603
1-[4-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxy-2-methylphenoxy]propyl (E)-3-hydroxy-2-methylprop-2-enoate (PubChem CID 139998603) has the molecular formula C33H35N3O5 and a molecular weight of 553.66 g/mol. Its IUPAC name is 1-[4-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxy-2-methylphenoxy]propyl (E)-3-hydroxy-2-methylprop-2-enoate.
| Compound Name | 1-[4-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxy-2-methylphenoxy]propyl (E)-3-hydroxy-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139998603 |
| Molecular Formula | C33H35N3O5 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | 1-[4-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxy-2-methylphenoxy]propyl (E)-3-hydroxy-2-methylprop-2-enoate |
| SMILES | CCC(OC(=O)/C(C)=C/O)Oc1ccc(-c2nc(-c3ccc(C)cc3C)nc(-c3ccc(C)cc3C)n2)c(O)c1C |
| InChI | InChI=1S/C33H35N3O5/c1-8-28(41-33(39)22(6)17-37)40-27-14-13-26(29(38)23(27)7)32-35-30(24-11-9-18(2)15-20(24)4)34-31(36-32)25-12-10-19(3)16-21(25)5/h9-17,28,37-38H,8H2,1-7H3/b22-17+ |
| InChIKey | JGJKLGUFUAGPHL-OQKWZONESA-N |
| XLogP | 7.24 |
| TPSA | 114.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|