C10H6Cl2N2S2 — CID 14003965
N-(3,5-dichloro-2-pyridinyl)thiophene-2-carbothioamide (PubChem CID 14003965) has the molecular formula C10H6Cl2N2S2 and a molecular weight of 289.21 g/mol. Its IUPAC name is N-(3,5-dichloro-2-pyridinyl)thiophene-2-carbothioamide.
| Compound Name | N-(3,5-dichloro-2-pyridinyl)thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 14003965 |
| Molecular Formula | C10H6Cl2N2S2 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 287.93 |
| IUPAC Name | N-(3,5-dichloro-2-pyridinyl)thiophene-2-carbothioamide |
| SMILES | S=C(Nc1ncc(Cl)cc1Cl)c1cccs1 |
| InChI | InChI=1S/C10H6Cl2N2S2/c11-6-4-7(12)9(13-5-6)14-10(15)8-2-1-3-16-8/h1-5H,(H,13,14,15) |
| InChIKey | YLKDTLCASRXTHE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|