C15H10Cl3N3O — CID 140501524
2-methoxy-N-(3,4,5-trichlorophenyl)quinazolin-4-amine (PubChem CID 140501524) has the molecular formula C15H10Cl3N3O and a molecular weight of 354.62 g/mol. Its IUPAC name is 2-methoxy-N-(3,4,5-trichlorophenyl)quinazolin-4-amine.
| Compound Name | 2-methoxy-N-(3,4,5-trichlorophenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 140501524 |
| Molecular Formula | C15H10Cl3N3O |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 2-methoxy-N-(3,4,5-trichlorophenyl)quinazolin-4-amine |
| SMILES | COc1nc(Nc2cc(Cl)c(Cl)c(Cl)c2)c2ccccc2n1 |
| InChI | InChI=1S/C15H10Cl3N3O/c1-22-15-20-12-5-3-2-4-9(12)14(21-15)19-8-6-10(16)13(18)11(17)7-8/h2-7H,1H3,(H,19,20,21) |
| InChIKey | UNYMLASVQNLGMZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|