C33H62O5 — CID 140536316
5-(1,2-dihydroxyethyl)-6-[(Z)-heptadec-8-enyl]-5-hydroxytetradecane-4,7-dione (PubChem CID 140536316) has the molecular formula C33H62O5 and a molecular weight of 538.85 g/mol. Its IUPAC name is 5-(1,2-dihydroxyethyl)-6-[(Z)-heptadec-8-enyl]-5-hydroxytetradecane-4,7-dione.
| Compound Name | 5-(1,2-dihydroxyethyl)-6-[(Z)-heptadec-8-enyl]-5-hydroxytetradecane-4,7-dione |
|---|---|
| PubChem CID | 140536316 |
| Molecular Formula | C33H62O5 |
| Molecular Weight | 538.85 g/mol |
| Exact Mass | 538.46 |
| IUPAC Name | 5-(1,2-dihydroxyethyl)-6-[(Z)-heptadec-8-enyl]-5-hydroxytetradecane-4,7-dione |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(C(=O)CCCCCCC)C(O)(C(=O)CCC)C(O)CO |
| InChI | InChI=1S/C33H62O5/c1-4-7-9-11-12-13-14-15-16-17-18-19-20-22-23-26-29(30(35)27-24-21-10-8-5-2)33(38,32(37)28-34)31(36)25-6-3/h15-16,29,32,34,37-38H,4-14,17-28H2,1-3H3/b16-15- |
| InChIKey | HWZSGRLRPVMADJ-NXVVXOECSA-N |
| XLogP | 8.02 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.85 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|