C19H39NO3 — CID 140564711
(Z,2S,3R)-2-amino-5-methoxyoctadec-4-ene-1,3-diol (PubChem CID 140564711) has the molecular formula C19H39NO3 and a molecular weight of 329.53 g/mol. Its IUPAC name is (Z,2S,3R)-2-amino-5-methoxyoctadec-4-ene-1,3-diol.
| Compound Name | (Z,2S,3R)-2-amino-5-methoxyoctadec-4-ene-1,3-diol |
|---|---|
| PubChem CID | 140564711 |
| Molecular Formula | C19H39NO3 |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.29 |
| IUPAC Name | (Z,2S,3R)-2-amino-5-methoxyoctadec-4-ene-1,3-diol |
| SMILES | CCCCCCCCCCCCC/C(=C/[C@@H](O)[C@@H](N)CO)OC |
| InChI | InChI=1S/C19H39NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-17(23-2)15-19(22)18(20)16-21/h15,18-19,21-22H,3-14,16,20H2,1-2H3/b17-15-/t18-,19+/m0/s1 |
| InChIKey | BEYOFOLGETZPAY-PIIWLPLESA-N |
| XLogP | 3.90 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|